C15H12BrClN2O3 — CID 25470533
N-(4-acetamido-3-chlorophenyl)-5-bromo-2-hydroxybenzamide (PubChem CID 25470533) has the molecular formula C15H12BrClN2O3 and a molecular weight of 383.63 g/mol. Its IUPAC name is N-(4-acetamido-3-chlorophenyl)-5-bromo-2-hydroxybenzamide.
| Compound Name | N-(4-acetamido-3-chlorophenyl)-5-bromo-2-hydroxybenzamide |
|---|---|
| PubChem CID | 25470533 |
| Molecular Formula | C15H12BrClN2O3 |
| Molecular Weight | 383.63 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | N-(4-acetamido-3-chlorophenyl)-5-bromo-2-hydroxybenzamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2cc(Br)ccc2O)cc1Cl |
| InChI | InChI=1S/C15H12BrClN2O3/c1-8(20)18-13-4-3-10(7-12(13)17)19-15(22)11-6-9(16)2-5-14(11)21/h2-7,21H,1H3,(H,18,20)(H,19,22) |
| InChIKey | MZWOCNKTZNSAMA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.63 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |