C12H16N4O3 — CID 25471332
2-[[4-(dimethylamino)benzoyl]amino]propanediamide (PubChem CID 25471332) has the molecular formula C12H16N4O3 and a molecular weight of 264.29 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)benzoyl]amino]propanediamide.
| Compound Name | 2-[[4-(dimethylamino)benzoyl]amino]propanediamide |
|---|---|
| PubChem CID | 25471332 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-[[4-(dimethylamino)benzoyl]amino]propanediamide |
| SMILES | CN(C)c1ccc(C(=O)NC(C(N)=O)C(N)=O)cc1 |
| InChI | InChI=1S/C12H16N4O3/c1-16(2)8-5-3-7(4-6-8)12(19)15-9(10(13)17)11(14)18/h3-6,9H,1-2H3,(H2,13,17)(H2,14,18)(H,15,19) |
| InChIKey | DARDIONBAXALFI-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|