C27H27NO4 — CID 25472791
(4-methoxyphenyl)-[1-(3-phenylmethoxybenzoyl)piperidin-4-yl]methanone (PubChem CID 25472791) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is (4-methoxyphenyl)-[1-(3-phenylmethoxybenzoyl)piperidin-4-yl]methanone.
| Compound Name | (4-methoxyphenyl)-[1-(3-phenylmethoxybenzoyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 25472791 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (4-methoxyphenyl)-[1-(3-phenylmethoxybenzoyl)piperidin-4-yl]methanone |
| SMILES | COc1ccc(C(=O)C2CCN(C(=O)c3cccc(OCc4ccccc4)c3)CC2)cc1 |
| InChI | InChI=1S/C27H27NO4/c1-31-24-12-10-21(11-13-24)26(29)22-14-16-28(17-15-22)27(30)23-8-5-9-25(18-23)32-19-20-6-3-2-4-7-20/h2-13,18,22H,14-17,19H2,1H3 |
| InChIKey | JSFYOIXMJRGKGD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |