C25H31NO5 — CID 25473149
[1-(3-ethoxy-4-propoxybenzoyl)piperidin-4-yl]-(4-methoxyphenyl)methanone (PubChem CID 25473149) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is [1-(3-ethoxy-4-propoxybenzoyl)piperidin-4-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [1-(3-ethoxy-4-propoxybenzoyl)piperidin-4-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 25473149 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | [1-(3-ethoxy-4-propoxybenzoyl)piperidin-4-yl]-(4-methoxyphenyl)methanone |
| SMILES | CCCOc1ccc(C(=O)N2CCC(C(=O)c3ccc(OC)cc3)CC2)cc1OCC |
| InChI | InChI=1S/C25H31NO5/c1-4-16-31-22-11-8-20(17-23(22)30-5-2)25(28)26-14-12-19(13-15-26)24(27)18-6-9-21(29-3)10-7-18/h6-11,17,19H,4-5,12-16H2,1-3H3 |
| InChIKey | LORAXYKAAXUFIV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |