C20H21F3N4OS — CID 25473780
5-(2-methylfuran-3-yl)-2-[[methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione (PubChem CID 25473780) has the molecular formula C20H21F3N4OS and a molecular weight of 422.48 g/mol. Its IUPAC name is 5-(2-methylfuran-3-yl)-2-[[methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione.
| Compound Name | 5-(2-methylfuran-3-yl)-2-[[methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 25473780 |
| Molecular Formula | C20H21F3N4OS |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 5-(2-methylfuran-3-yl)-2-[[methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione |
| SMILES | C=CCn1c(-c2ccoc2C)nn(CN(C)Cc2ccc(C(F)(F)F)cc2)c1=S |
| InChI | InChI=1S/C20H21F3N4OS/c1-4-10-26-18(17-9-11-28-14(17)2)24-27(19(26)29)13-25(3)12-15-5-7-16(8-6-15)20(21,22)23/h4-9,11H,1,10,12-13H2,2-3H3 |
| InChIKey | CVHMMNXWESUWBZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 39.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|