C23H25Cl2N5O2S — CID 2547393
N-(2,5-dichlorophenyl)-2-[[2-(morpholin-4-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]acetamide (PubChem CID 2547393) has the molecular formula C23H25Cl2N5O2S and a molecular weight of 506.46 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-[[2-(morpholin-4-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-[[2-(morpholin-4-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]acetamide |
|---|---|
| PubChem CID | 2547393 |
| Molecular Formula | C23H25Cl2N5O2S |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-[[2-(morpholin-4-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]acetamide |
| SMILES | O=C(CNc1nc(CN2CCOCC2)nc2sc3c(c12)CCCC3)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C23H25Cl2N5O2S/c24-14-5-6-16(25)17(11-14)27-20(31)12-26-22-21-15-3-1-2-4-18(15)33-23(21)29-19(28-22)13-30-7-9-32-10-8-30/h5-6,11H,1-4,7-10,12-13H2,(H,27,31)(H,26,28,29) |
| InChIKey | TVGNWAYHVBSECU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |