About N-(2-chloro-4,6-dimethylphenyl)-3,3-dimethylbutanamide
N-(2-chloro-4,6-dimethylphenyl)-3,3-dimethylbutanamide (PubChem CID 2547402) has the molecular formula C14H20ClNO
and a molecular weight of 253.77 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-3,3-dimethylbutanamide.
Molecular Properties
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-3,3-dimethylbutanamide |
| PubChem CID | 2547402 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-3,3-dimethylbutanamide |
| SMILES | Cc1cc(C)c(NC(=O)CC(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C14H20ClNO/c1-9-6-10(2)13(11(15)7-9)16-12(17)8-14(3,4)5/h6-7H,8H2,1-5H3,(H,16,17) |
| InChIKey | QEJBGYQXOYBBOU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2-chloro-4,6-dimethylphenyl)-3,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloro-4,6-dimethylphenyl)-3,3-dimethylbutanamide?
The IUPAC name of N-(2-chloro-4,6-dimethylphenyl)-3,3-dimethylbutanamide (CID 2547402) is N-(2-chloro-4,6-dimethylphenyl)-3,3-dimethylbutanamide.
What is the SMILES notation for N-(2-chloro-4,6-dimethylphenyl)-3,3-dimethylbutanamide?
The canonical SMILES for N-(2-chloro-4,6-dimethylphenyl)-3,3-dimethylbutanamide is Cc1cc(C)c(NC(=O)CC(C)(C)C)c(Cl)c1.
What is the InChIKey of N-(2-chloro-4,6-dimethylphenyl)-3,3-dimethylbutanamide?
The InChIKey is QEJBGYQXOYBBOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClNO/c1-9-6-10(2)13(11(15)7-9)16-12(17)8-14(3,4)5/h6-7H,8H2,1-5H3,(H,16,17).
What are the key properties of N-(2-chloro-4,6-dimethylphenyl)-3,3-dimethylbutanamide?
N-(2-chloro-4,6-dimethylphenyl)-3,3-dimethylbutanamide has a molecular weight of 253.77 g/mol, XLogP of 4.33, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloro-4,6-dimethylphenyl)-3,3-dimethylbutanamide is sourced from PubChem (CID 2547402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).