C18H20N4O5 — CID 25474083
N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]-2-(4-nitroimidazol-1-yl)acetamide (PubChem CID 25474083) has the molecular formula C18H20N4O5 and a molecular weight of 372.38 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]-2-(4-nitroimidazol-1-yl)acetamide.
| Compound Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]-2-(4-nitroimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 25474083 |
| Molecular Formula | C18H20N4O5 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]-2-(4-nitroimidazol-1-yl)acetamide |
| SMILES | O=C(Cn1cnc([N+](=O)[O-])c1)NC1(c2ccc3c(c2)OCCO3)CCCC1 |
| InChI | InChI=1S/C18H20N4O5/c23-17(11-21-10-16(19-12-21)22(24)25)20-18(5-1-2-6-18)13-3-4-14-15(9-13)27-8-7-26-14/h3-4,9-10,12H,1-2,5-8,11H2,(H,20,23) |
| InChIKey | YDQDXYLKWOWFTO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|