C17H28N4O3 — CID 25474622
1-[(2S)-2-(diethylamino)-4-methylpentyl]-3-(2-nitrophenyl)urea (PubChem CID 25474622) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-[(2S)-2-(diethylamino)-4-methylpentyl]-3-(2-nitrophenyl)urea.
| Compound Name | 1-[(2S)-2-(diethylamino)-4-methylpentyl]-3-(2-nitrophenyl)urea |
|---|---|
| PubChem CID | 25474622 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 1-[(2S)-2-(diethylamino)-4-methylpentyl]-3-(2-nitrophenyl)urea |
| SMILES | CCN(CC)[C@H](CNC(=O)Nc1ccccc1[N+](=O)[O-])CC(C)C |
| InChI | InChI=1S/C17H28N4O3/c1-5-20(6-2)14(11-13(3)4)12-18-17(22)19-15-9-7-8-10-16(15)21(23)24/h7-10,13-14H,5-6,11-12H2,1-4H3,(H2,18,19,22)/t14-/m0/s1 |
| InChIKey | KRJBQAWLCVMEBI-AWEZNQCLSA-N |
| XLogP | 3.47 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|