C20H23NO3S — CID 25474842
1-[4-(4-methoxybenzoyl)piperidin-1-yl]-3-thiophen-3-ylpropan-1-one (PubChem CID 25474842) has the molecular formula C20H23NO3S and a molecular weight of 357.48 g/mol. Its IUPAC name is 1-[4-(4-methoxybenzoyl)piperidin-1-yl]-3-thiophen-3-ylpropan-1-one.
| Compound Name | 1-[4-(4-methoxybenzoyl)piperidin-1-yl]-3-thiophen-3-ylpropan-1-one |
|---|---|
| PubChem CID | 25474842 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 1-[4-(4-methoxybenzoyl)piperidin-1-yl]-3-thiophen-3-ylpropan-1-one |
| SMILES | COc1ccc(C(=O)C2CCN(C(=O)CCc3ccsc3)CC2)cc1 |
| InChI | InChI=1S/C20H23NO3S/c1-24-18-5-3-16(4-6-18)20(23)17-8-11-21(12-9-17)19(22)7-2-15-10-13-25-14-15/h3-6,10,13-14,17H,2,7-9,11-12H2,1H3 |
| InChIKey | KBXOFKQSCHKRIC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |