C20H19BrFNO3 — CID 25475454
[1-(4-bromo-2-fluorobenzoyl)piperidin-4-yl]-(4-methoxyphenyl)methanone (PubChem CID 25475454) has the molecular formula C20H19BrFNO3 and a molecular weight of 420.28 g/mol. Its IUPAC name is [1-(4-bromo-2-fluorobenzoyl)piperidin-4-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [1-(4-bromo-2-fluorobenzoyl)piperidin-4-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 25475454 |
| Molecular Formula | C20H19BrFNO3 |
| Molecular Weight | 420.28 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | [1-(4-bromo-2-fluorobenzoyl)piperidin-4-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)C2CCN(C(=O)c3ccc(Br)cc3F)CC2)cc1 |
| InChI | InChI=1S/C20H19BrFNO3/c1-26-16-5-2-13(3-6-16)19(24)14-8-10-23(11-9-14)20(25)17-7-4-15(21)12-18(17)22/h2-7,12,14H,8-11H2,1H3 |
| InChIKey | MCSUFKNCKDVKAJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.28 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |