About N-(5-methyl-1,3-thiazol-2-yl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide
N-(5-methyl-1,3-thiazol-2-yl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide (PubChem CID 25475831) has the molecular formula C18H14F3N3O3S2
and a molecular weight of 441.46 g/mol. Its IUPAC name is N-(5-methyl-1,3-thiazol-2-yl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide.
Molecular Properties
| Compound Name | N-(5-methyl-1,3-thiazol-2-yl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide |
| PubChem CID | 25475831 |
| Molecular Formula | C18H14F3N3O3S2 |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | N-(5-methyl-1,3-thiazol-2-yl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide |
| SMILES | Cc1cnc(NC(=O)c2ccccc2NS(=O)(=O)c2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C18H14F3N3O3S2/c1-11-10-22-17(28-11)23-16(25)14-7-2-3-8-15(14)24-29(26,27)13-6-4-5-12(9-13)18(19,20)21/h2-10,24H,1H3,(H,22,23,25) |
| InChIKey | YOLIGOYXYFICFW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(5-methyl-1,3-thiazol-2-yl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methyl-1,3-thiazol-2-yl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide?
The IUPAC name of N-(5-methyl-1,3-thiazol-2-yl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide (CID 25475831) is N-(5-methyl-1,3-thiazol-2-yl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide.
What is the SMILES notation for N-(5-methyl-1,3-thiazol-2-yl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide?
The canonical SMILES for N-(5-methyl-1,3-thiazol-2-yl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide is Cc1cnc(NC(=O)c2ccccc2NS(=O)(=O)c2cccc(C(F)(F)F)c2)s1.
What is the InChIKey of N-(5-methyl-1,3-thiazol-2-yl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide?
The InChIKey is YOLIGOYXYFICFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F3N3O3S2/c1-11-10-22-17(28-11)23-16(25)14-7-2-3-8-15(14)24-29(26,27)13-6-4-5-12(9-13)18(19,20)21/h2-10,24H,1H3,(H,22,23,25).
What are the key properties of N-(5-methyl-1,3-thiazol-2-yl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide?
N-(5-methyl-1,3-thiazol-2-yl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide has a molecular weight of 441.46 g/mol, XLogP of 4.52, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methyl-1,3-thiazol-2-yl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide is sourced from PubChem (CID 25475831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).