About [(2R)-1-(2,5-dimethylphenyl)-1-oxopropan-2-yl] 2-phenyltriazole-4-carboxylate
[(2R)-1-(2,5-dimethylphenyl)-1-oxopropan-2-yl] 2-phenyltriazole-4-carboxylate (PubChem CID 25476452) has the molecular formula C20H19N3O3
and a molecular weight of 349.39 g/mol. Its IUPAC name is [(2R)-1-(2,5-dimethylphenyl)-1-oxopropan-2-yl] 2-phenyltriazole-4-carboxylate.
Molecular Properties
| Compound Name | [(2R)-1-(2,5-dimethylphenyl)-1-oxopropan-2-yl] 2-phenyltriazole-4-carboxylate |
| PubChem CID | 25476452 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | [(2R)-1-(2,5-dimethylphenyl)-1-oxopropan-2-yl] 2-phenyltriazole-4-carboxylate |
| SMILES | Cc1ccc(C)c(C(=O)[C@@H](C)OC(=O)c2cnn(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C20H19N3O3/c1-13-9-10-14(2)17(11-13)19(24)15(3)26-20(25)18-12-21-23(22-18)16-7-5-4-6-8-16/h4-12,15H,1-3H3/t15-/m1/s1 |
| InChIKey | PBPVCTVWWKENKS-OAHLLOKOSA-N |
| XLogP | 3.31 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(2R)-1-(2,5-dimethylphenyl)-1-oxopropan-2-yl] 2-phenyltriazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-(2,5-dimethylphenyl)-1-oxopropan-2-yl] 2-phenyltriazole-4-carboxylate?
The IUPAC name of [(2R)-1-(2,5-dimethylphenyl)-1-oxopropan-2-yl] 2-phenyltriazole-4-carboxylate (CID 25476452) is [(2R)-1-(2,5-dimethylphenyl)-1-oxopropan-2-yl] 2-phenyltriazole-4-carboxylate.
What is the SMILES notation for [(2R)-1-(2,5-dimethylphenyl)-1-oxopropan-2-yl] 2-phenyltriazole-4-carboxylate?
The canonical SMILES for [(2R)-1-(2,5-dimethylphenyl)-1-oxopropan-2-yl] 2-phenyltriazole-4-carboxylate is Cc1ccc(C)c(C(=O)[C@@H](C)OC(=O)c2cnn(-c3ccccc3)n2)c1.
What is the InChIKey of [(2R)-1-(2,5-dimethylphenyl)-1-oxopropan-2-yl] 2-phenyltriazole-4-carboxylate?
The InChIKey is PBPVCTVWWKENKS-OAHLLOKOSA-N. The full InChI is InChI=1S/C20H19N3O3/c1-13-9-10-14(2)17(11-13)19(24)15(3)26-20(25)18-12-21-23(22-18)16-7-5-4-6-8-16/h4-12,15H,1-3H3/t15-/m1/s1.
What are the key properties of [(2R)-1-(2,5-dimethylphenyl)-1-oxopropan-2-yl] 2-phenyltriazole-4-carboxylate?
[(2R)-1-(2,5-dimethylphenyl)-1-oxopropan-2-yl] 2-phenyltriazole-4-carboxylate has a molecular weight of 349.39 g/mol, XLogP of 3.31, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-(2,5-dimethylphenyl)-1-oxopropan-2-yl] 2-phenyltriazole-4-carboxylate is sourced from PubChem (CID 25476452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).