C24H22N4O5 — CID 25478772
N-[2-[1-(2-oxo-2-phenylacetyl)piperidin-4-yl]pyrazol-3-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 25478772) has the molecular formula C24H22N4O5 and a molecular weight of 446.46 g/mol. Its IUPAC name is N-[2-[1-(2-oxo-2-phenylacetyl)piperidin-4-yl]pyrazol-3-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[1-(2-oxo-2-phenylacetyl)piperidin-4-yl]pyrazol-3-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 25478772 |
| Molecular Formula | C24H22N4O5 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | N-[2-[1-(2-oxo-2-phenylacetyl)piperidin-4-yl]pyrazol-3-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1ccnn1C1CCN(C(=O)C(=O)c2ccccc2)CC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H22N4O5/c29-22(16-4-2-1-3-5-16)24(31)27-12-9-18(10-13-27)28-21(8-11-25-28)26-23(30)17-6-7-19-20(14-17)33-15-32-19/h1-8,11,14,18H,9-10,12-13,15H2,(H,26,30) |
| InChIKey | LHRGTXRJWLVQCS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|