C21H22F2N2O4 — CID 25479486
4-(difluoromethoxy)-N-[2-[(2R)-2-(4-methoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]benzamide (PubChem CID 25479486) has the molecular formula C21H22F2N2O4 and a molecular weight of 404.41 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[2-[(2R)-2-(4-methoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]benzamide.
| Compound Name | 4-(difluoromethoxy)-N-[2-[(2R)-2-(4-methoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 25479486 |
| Molecular Formula | C21H22F2N2O4 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 4-(difluoromethoxy)-N-[2-[(2R)-2-(4-methoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]benzamide |
| SMILES | COc1ccc([C@H]2CCCN2C(=O)CNC(=O)c2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H22F2N2O4/c1-28-16-8-4-14(5-9-16)18-3-2-12-25(18)19(26)13-24-20(27)15-6-10-17(11-7-15)29-21(22)23/h4-11,18,21H,2-3,12-13H2,1H3,(H,24,27)/t18-/m1/s1 |
| InChIKey | UMXJBKYRRNOFKV-GOSISDBHSA-N |
| XLogP | 3.39 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |