C15H16IN3O4S — CID 25479676
1-[(3S)-1,1-dioxothiolan-3-yl]-N-(3-iodophenyl)-6-oxo-4,5-dihydropyridazine-3-carboxamide (PubChem CID 25479676) has the molecular formula C15H16IN3O4S and a molecular weight of 461.28 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-N-(3-iodophenyl)-6-oxo-4,5-dihydropyridazine-3-carboxamide.
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-N-(3-iodophenyl)-6-oxo-4,5-dihydropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 25479676 |
| Molecular Formula | C15H16IN3O4S |
| Molecular Weight | 461.28 g/mol |
| Exact Mass | 460.99 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-N-(3-iodophenyl)-6-oxo-4,5-dihydropyridazine-3-carboxamide |
| SMILES | O=C(Nc1cccc(I)c1)C1=NN([C@H]2CCS(=O)(=O)C2)C(=O)CC1 |
| InChI | InChI=1S/C15H16IN3O4S/c16-10-2-1-3-11(8-10)17-15(21)13-4-5-14(20)19(18-13)12-6-7-24(22,23)9-12/h1-3,8,12H,4-7,9H2,(H,17,21)/t12-/m0/s1 |
| InChIKey | BIONHFPCZLBRRI-LBPRGKRZSA-N |
| XLogP | 1.40 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|