C22H21N3O6S — CID 2547983
[2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 3-(benzylsulfamoyl)benzoate (PubChem CID 2547983) has the molecular formula C22H21N3O6S and a molecular weight of 455.49 g/mol. Its IUPAC name is [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 3-(benzylsulfamoyl)benzoate.
| Compound Name | [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 3-(benzylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2547983 |
| Molecular Formula | C22H21N3O6S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 3-(benzylsulfamoyl)benzoate |
| SMILES | Cn1cccc1C(=O)NC(=O)COC(=O)c1cccc(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C22H21N3O6S/c1-25-12-6-11-19(25)21(27)24-20(26)15-31-22(28)17-9-5-10-18(13-17)32(29,30)23-14-16-7-3-2-4-8-16/h2-13,23H,14-15H2,1H3,(H,24,26,27) |
| InChIKey | LHPFGFUZPIXOBH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |