C15H13Cl2N5O3S2 — CID 2548285
2-[[5-(2,5-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide (PubChem CID 2548285) has the molecular formula C15H13Cl2N5O3S2 and a molecular weight of 446.34 g/mol. Its IUPAC name is 2-[[5-(2,5-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide.
| Compound Name | 2-[[5-(2,5-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 2548285 |
| Molecular Formula | C15H13Cl2N5O3S2 |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 444.98 |
| IUPAC Name | 2-[[5-(2,5-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide |
| SMILES | O=C(CSc1n[nH]c(-c2cc(Cl)ccc2Cl)n1)NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C15H13Cl2N5O3S2/c16-8-1-2-10(17)9(5-8)13-19-14(21-20-13)26-6-11(23)18-3-4-22-12(24)7-27-15(22)25/h1-2,5H,3-4,6-7H2,(H,18,23)(H,19,20,21) |
| InChIKey | HRNFYMAZHNVFSY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|