C13H17ClN2O5S — CID 25484227
methyl (2R)-2-[[4-chloro-3-(dimethylsulfamoyl)benzoyl]amino]propanoate (PubChem CID 25484227) has the molecular formula C13H17ClN2O5S and a molecular weight of 348.81 g/mol. Its IUPAC name is methyl (2R)-2-[[4-chloro-3-(dimethylsulfamoyl)benzoyl]amino]propanoate.
| Compound Name | methyl (2R)-2-[[4-chloro-3-(dimethylsulfamoyl)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 25484227 |
| Molecular Formula | C13H17ClN2O5S |
| Molecular Weight | 348.81 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | methyl (2R)-2-[[4-chloro-3-(dimethylsulfamoyl)benzoyl]amino]propanoate |
| SMILES | COC(=O)[C@@H](C)NC(=O)c1ccc(Cl)c(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C13H17ClN2O5S/c1-8(13(18)21-4)15-12(17)9-5-6-10(14)11(7-9)22(19,20)16(2)3/h5-8H,1-4H3,(H,15,17)/t8-/m1/s1 |
| InChIKey | XAPOREAPCHPEGO-MRVPVSSYSA-N |
| XLogP | 0.88 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.81 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |