C19H19F4N3O2 — CID 2548450
N-[2-(4-fluorophenyl)ethyl]-2-[methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]acetamide (PubChem CID 2548450) has the molecular formula C19H19F4N3O2 and a molecular weight of 397.37 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-2-[methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]acetamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-2-[methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 2548450 |
| Molecular Formula | C19H19F4N3O2 |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-2-[methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]acetamide |
| SMILES | CN(CC(=O)NCCc1ccc(F)cc1)CC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H19F4N3O2/c1-26(10-16(27)24-9-8-12-2-4-13(20)5-3-12)11-17(28)25-15-7-6-14(21)18(22)19(15)23/h2-7H,8-11H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | YLKNQGGBDGCOST-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|