C21H18BrFN2O3S — CID 25487605
N-(2-bromo-4-methylphenyl)-2-(N-(2-fluorophenyl)sulfonylanilino)acetamide (PubChem CID 25487605) has the molecular formula C21H18BrFN2O3S and a molecular weight of 477.36 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-2-(N-(2-fluorophenyl)sulfonylanilino)acetamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-2-(N-(2-fluorophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 25487605 |
| Molecular Formula | C21H18BrFN2O3S |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 476.02 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-2-(N-(2-fluorophenyl)sulfonylanilino)acetamide |
| SMILES | Cc1ccc(NC(=O)CN(c2ccccc2)S(=O)(=O)c2ccccc2F)c(Br)c1 |
| InChI | InChI=1S/C21H18BrFN2O3S/c1-15-11-12-19(17(22)13-15)24-21(26)14-25(16-7-3-2-4-8-16)29(27,28)20-10-6-5-9-18(20)23/h2-13H,14H2,1H3,(H,24,26) |
| InChIKey | MWBYXXUSSWNSNB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |