C20H29N3OS — CID 25489193
[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[3-methyl-1-(2-methylpropyl)thieno[3,2-d]pyrazol-5-yl]methanone (PubChem CID 25489193) has the molecular formula C20H29N3OS and a molecular weight of 359.54 g/mol. Its IUPAC name is [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[3-methyl-1-(2-methylpropyl)thieno[3,2-d]pyrazol-5-yl]methanone.
| Compound Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[3-methyl-1-(2-methylpropyl)thieno[3,2-d]pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 25489193 |
| Molecular Formula | C20H29N3OS |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[3-methyl-1-(2-methylpropyl)thieno[3,2-d]pyrazol-5-yl]methanone |
| SMILES | Cc1nn(CC(C)C)c2sc(C(=O)N3CC[C@@H]4CCCC[C@@H]4C3)cc12 |
| InChI | InChI=1S/C20H29N3OS/c1-13(2)11-23-20-17(14(3)21-23)10-18(25-20)19(24)22-9-8-15-6-4-5-7-16(15)12-22/h10,13,15-16H,4-9,11-12H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | AXKZCKAWEGGPAK-JKSUJKDBSA-N |
| XLogP | 4.71 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |