C9H8ClF3N4O — CID 25489712
5-(chloromethyl)-7-ethoxy-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 25489712) has the molecular formula C9H8ClF3N4O and a molecular weight of 280.64 g/mol. Its IUPAC name is 5-(chloromethyl)-7-ethoxy-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 5-(chloromethyl)-7-ethoxy-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 25489712 |
| Molecular Formula | C9H8ClF3N4O |
| Molecular Weight | 280.64 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 5-(chloromethyl)-7-ethoxy-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | CCOc1cc(CCl)nc2nc(C(F)(F)F)nn12 |
| InChI | InChI=1S/C9H8ClF3N4O/c1-2-18-6-3-5(4-10)14-8-15-7(9(11,12)13)16-17(6)8/h3H,2,4H2,1H3 |
| InChIKey | UWWZKZDMXKQKPF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.64 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|