About 5-bromo-3-methyl-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-1-benzofuran-2-carbohydrazide
5-bromo-3-methyl-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-1-benzofuran-2-carbohydrazide (PubChem CID 25490154) has the molecular formula C20H17BrN4O3
and a molecular weight of 441.29 g/mol. Its IUPAC name is 5-bromo-3-methyl-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-1-benzofuran-2-carbohydrazide.
Molecular Properties
| Compound Name | 5-bromo-3-methyl-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-1-benzofuran-2-carbohydrazide |
| PubChem CID | 25490154 |
| Molecular Formula | C20H17BrN4O3 |
| Molecular Weight | 441.29 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 5-bromo-3-methyl-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)Cc2nc3ccccc3n2C)oc2ccc(Br)cc12 |
| InChI | InChI=1S/C20H17BrN4O3/c1-11-13-9-12(21)7-8-16(13)28-19(11)20(27)24-23-18(26)10-17-22-14-5-3-4-6-15(14)25(17)2/h3-9H,10H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | COUXXSHLOSYOBV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-3-methyl-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-1-benzofuran-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-methyl-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-1-benzofuran-2-carbohydrazide?
The IUPAC name of 5-bromo-3-methyl-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-1-benzofuran-2-carbohydrazide (CID 25490154) is 5-bromo-3-methyl-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-1-benzofuran-2-carbohydrazide.
What is the SMILES notation for 5-bromo-3-methyl-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-1-benzofuran-2-carbohydrazide?
The canonical SMILES for 5-bromo-3-methyl-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-1-benzofuran-2-carbohydrazide is Cc1c(C(=O)NNC(=O)Cc2nc3ccccc3n2C)oc2ccc(Br)cc12.
What is the InChIKey of 5-bromo-3-methyl-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-1-benzofuran-2-carbohydrazide?
The InChIKey is COUXXSHLOSYOBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17BrN4O3/c1-11-13-9-12(21)7-8-16(13)28-19(11)20(27)24-23-18(26)10-17-22-14-5-3-4-6-15(14)25(17)2/h3-9H,10H2,1-2H3,(H,23,26)(H,24,27).
What are the key properties of 5-bromo-3-methyl-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-1-benzofuran-2-carbohydrazide?
5-bromo-3-methyl-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-1-benzofuran-2-carbohydrazide has a molecular weight of 441.29 g/mol, XLogP of 3.39, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-methyl-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-1-benzofuran-2-carbohydrazide is sourced from PubChem (CID 25490154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).