C8H13ClN2O — CID 25490822
3-butyl-5-[(1S)-1-chloroethyl]-1,2,4-oxadiazole (PubChem CID 25490822) has the molecular formula C8H13ClN2O and a molecular weight of 188.66 g/mol. Its IUPAC name is 3-butyl-5-[(1S)-1-chloroethyl]-1,2,4-oxadiazole.
| Compound Name | 3-butyl-5-[(1S)-1-chloroethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 25490822 |
| Molecular Formula | C8H13ClN2O |
| Molecular Weight | 188.66 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 3-butyl-5-[(1S)-1-chloroethyl]-1,2,4-oxadiazole |
| SMILES | CCCCc1noc([C@H](C)Cl)n1 |
| InChI | InChI=1S/C8H13ClN2O/c1-3-4-5-7-10-8(6(2)9)12-11-7/h6H,3-5H2,1-2H3/t6-/m0/s1 |
| InChIKey | ZENRJUHCFROHJI-LURJTMIESA-N |
| XLogP | 2.71 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.66 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|