C20H20O9S — CID 25493165
diethyl 5-(3-methoxycarbonylphenyl)sulfonyloxybenzene-1,3-dicarboxylate (PubChem CID 25493165) has the molecular formula C20H20O9S and a molecular weight of 436.44 g/mol. Its IUPAC name is diethyl 5-(3-methoxycarbonylphenyl)sulfonyloxybenzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-(3-methoxycarbonylphenyl)sulfonyloxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 25493165 |
| Molecular Formula | C20H20O9S |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | diethyl 5-(3-methoxycarbonylphenyl)sulfonyloxybenzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(OS(=O)(=O)c2cccc(C(=O)OC)c2)cc(C(=O)OCC)c1 |
| InChI | InChI=1S/C20H20O9S/c1-4-27-19(22)14-9-15(20(23)28-5-2)11-16(10-14)29-30(24,25)17-8-6-7-13(12-17)18(21)26-3/h6-12H,4-5H2,1-3H3 |
| InChIKey | LEWLQMNADWCWAI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|