C22H23N3O5S — CID 25494007
[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(4-ethoxy-5-methoxy-2-nitrophenyl)methanone (PubChem CID 25494007) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is [(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(4-ethoxy-5-methoxy-2-nitrophenyl)methanone.
| Compound Name | [(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(4-ethoxy-5-methoxy-2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 25494007 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | [(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(4-ethoxy-5-methoxy-2-nitrophenyl)methanone |
| SMILES | CCOc1cc([N+](=O)[O-])c(C(=O)N2CCC[C@H](c3nc4ccccc4s3)C2)cc1OC |
| InChI | InChI=1S/C22H23N3O5S/c1-3-30-19-12-17(25(27)28)15(11-18(19)29-2)22(26)24-10-6-7-14(13-24)21-23-16-8-4-5-9-20(16)31-21/h4-5,8-9,11-12,14H,3,6-7,10,13H2,1-2H3/t14-/m0/s1 |
| InChIKey | WAEVUSSUDMBJNV-AWEZNQCLSA-N |
| XLogP | 4.63 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|