C14H15N5O2S2 — CID 25494449
N-(prop-2-enylcarbamoyl)-2-[[5-[(E)-2-thiophen-2-ylethenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 25494449) has the molecular formula C14H15N5O2S2 and a molecular weight of 349.44 g/mol. Its IUPAC name is N-(prop-2-enylcarbamoyl)-2-[[5-[(E)-2-thiophen-2-ylethenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(prop-2-enylcarbamoyl)-2-[[5-[(E)-2-thiophen-2-ylethenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 25494449 |
| Molecular Formula | C14H15N5O2S2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | N-(prop-2-enylcarbamoyl)-2-[[5-[(E)-2-thiophen-2-ylethenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCNC(=O)NC(=O)CSc1n[nH]c(/C=C/c2cccs2)n1 |
| InChI | InChI=1S/C14H15N5O2S2/c1-2-7-15-13(21)17-12(20)9-23-14-16-11(18-19-14)6-5-10-4-3-8-22-10/h2-6,8H,1,7,9H2,(H,16,18,19)(H2,15,17,20,21)/b6-5+ |
| InChIKey | GZFSAGHCANKVSN-AATRIKPKSA-N |
| XLogP | 2.14 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|