C18H14Cl2N2O3S2 — CID 25494557
N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-methylsulfonylbenzamide (PubChem CID 25494557) has the molecular formula C18H14Cl2N2O3S2 and a molecular weight of 441.36 g/mol. Its IUPAC name is N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-methylsulfonylbenzamide.
| Compound Name | N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 25494557 |
| Molecular Formula | C18H14Cl2N2O3S2 |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccccc1C(=O)Nc1ncc(Cc2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C18H14Cl2N2O3S2/c1-27(24,25)16-5-3-2-4-13(16)17(23)22-18-21-10-12(26-18)8-11-6-7-14(19)15(20)9-11/h2-7,9-10H,8H2,1H3,(H,21,22,23) |
| InChIKey | ZZGQOXYKPDTZPG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |