C19H27N5O5S2 — CID 25495951
N'-(4-tert-butyl-2,6-dimethylphenyl)sulfonyl-2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]acetohydrazide (PubChem CID 25495951) has the molecular formula C19H27N5O5S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is N'-(4-tert-butyl-2,6-dimethylphenyl)sulfonyl-2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]acetohydrazide.
| Compound Name | N'-(4-tert-butyl-2,6-dimethylphenyl)sulfonyl-2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 25495951 |
| Molecular Formula | C19H27N5O5S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | N'-(4-tert-butyl-2,6-dimethylphenyl)sulfonyl-2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]acetohydrazide |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1S(=O)(=O)NNC(=O)CSc1nn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C19H27N5O5S2/c1-11-8-13(19(3,4)5)9-12(2)15(11)31(28,29)22-20-14(25)10-30-16-17(26)23(6)18(27)24(7)21-16/h8-9,22H,10H2,1-7H3,(H,20,25) |
| InChIKey | LMCAQLANHJIQHF-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|