C14H12N2OS2 — CID 2550244
N-(2-methyl-1,3-benzothiazol-6-yl)-2-thiophen-3-ylacetamide (PubChem CID 2550244) has the molecular formula C14H12N2OS2 and a molecular weight of 288.40 g/mol. Its IUPAC name is N-(2-methyl-1,3-benzothiazol-6-yl)-2-thiophen-3-ylacetamide.
| Compound Name | N-(2-methyl-1,3-benzothiazol-6-yl)-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 2550244 |
| Molecular Formula | C14H12N2OS2 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | N-(2-methyl-1,3-benzothiazol-6-yl)-2-thiophen-3-ylacetamide |
| SMILES | Cc1nc2ccc(NC(=O)Cc3ccsc3)cc2s1 |
| InChI | InChI=1S/C14H12N2OS2/c1-9-15-12-3-2-11(7-13(12)19-9)16-14(17)6-10-4-5-18-8-10/h2-5,7-8H,6H2,1H3,(H,16,17) |
| InChIKey | BZPZOSJVDQKSOT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |