C16H13F3N4O2S2 — CID 2550943
4-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]thieno[2,3-d]pyrimidine (PubChem CID 2550943) has the molecular formula C16H13F3N4O2S2 and a molecular weight of 414.43 g/mol. Its IUPAC name is 4-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]thieno[2,3-d]pyrimidine.
| Compound Name | 4-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 2550943 |
| Molecular Formula | C16H13F3N4O2S2 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | 4-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]thieno[2,3-d]pyrimidine |
| SMILES | O=S(=O)(c1ccc(F)c(F)c1F)N1CCN(c2ncnc3sccc23)CC1 |
| InChI | InChI=1S/C16H13F3N4O2S2/c17-11-1-2-12(14(19)13(11)18)27(24,25)23-6-4-22(5-7-23)15-10-3-8-26-16(10)21-9-20-15/h1-3,8-9H,4-7H2 |
| InChIKey | BIHSUNPJWQSVSF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|