C17H23N3O3S — CID 2551998
2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 2551998) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 2551998 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCCCCCC2)C1=O)NCc1cccs1 |
| InChI | InChI=1S/C17H23N3O3S/c21-14(18-11-13-7-6-10-24-13)12-20-15(22)17(19-16(20)23)8-4-2-1-3-5-9-17/h6-7,10H,1-5,8-9,11-12H2,(H,18,21)(H,19,23) |
| InChIKey | WIHWOHFNYIJEFH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|