About (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 2-ethoxypyridine-3-carboxylate
(4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 2-ethoxypyridine-3-carboxylate (PubChem CID 2553083) has the molecular formula C19H15N3O4S
and a molecular weight of 381.41 g/mol. Its IUPAC name is (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 2-ethoxypyridine-3-carboxylate.
Molecular Properties
| Compound Name | (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 2-ethoxypyridine-3-carboxylate |
| PubChem CID | 2553083 |
| Molecular Formula | C19H15N3O4S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 2-ethoxypyridine-3-carboxylate |
| SMILES | CCOc1ncccc1C(=O)OCc1cc(=O)n2c(n1)sc1ccccc12 |
| InChI | InChI=1S/C19H15N3O4S/c1-2-25-17-13(6-5-9-20-17)18(24)26-11-12-10-16(23)22-14-7-3-4-8-15(14)27-19(22)21-12/h3-10H,2,11H2,1H3 |
| InChIKey | ALSFLHBUXKPEFB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 2-ethoxypyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 2-ethoxypyridine-3-carboxylate?
The IUPAC name of (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 2-ethoxypyridine-3-carboxylate (CID 2553083) is (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 2-ethoxypyridine-3-carboxylate.
What is the SMILES notation for (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 2-ethoxypyridine-3-carboxylate?
The canonical SMILES for (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 2-ethoxypyridine-3-carboxylate is CCOc1ncccc1C(=O)OCc1cc(=O)n2c(n1)sc1ccccc12.
What is the InChIKey of (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 2-ethoxypyridine-3-carboxylate?
The InChIKey is ALSFLHBUXKPEFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O4S/c1-2-25-17-13(6-5-9-20-17)18(24)26-11-12-10-16(23)22-14-7-3-4-8-15(14)27-19(22)21-12/h3-10H,2,11H2,1H3.
What are the key properties of (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 2-ethoxypyridine-3-carboxylate?
(4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 2-ethoxypyridine-3-carboxylate has a molecular weight of 381.41 g/mol, XLogP of 3.06, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 2-ethoxypyridine-3-carboxylate is sourced from PubChem (CID 2553083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).