C17H23NO5S — CID 2553743
(3,3-dimethyl-2-oxobutyl) 4-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 2553743) has the molecular formula C17H23NO5S and a molecular weight of 353.44 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 4-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 4-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2553743 |
| Molecular Formula | C17H23NO5S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 4-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | CC(C)(C)C(=O)COC(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C17H23NO5S/c1-17(2,3)15(19)12-23-16(20)13-6-8-14(9-7-13)24(21,22)18-10-4-5-11-18/h6-9H,4-5,10-12H2,1-3H3 |
| InChIKey | WWZXGRDGNQATND-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |