C24H27N2O2+ — CID 2553869
(3-methoxyphenyl)methyl-methyl-[(1R)-2-(4-methylanilino)-2-oxo-1-phenylethyl]azanium (PubChem CID 2553869) has the molecular formula C24H27N2O2+ and a molecular weight of 375.49 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl-methyl-[(1R)-2-(4-methylanilino)-2-oxo-1-phenylethyl]azanium.
| Compound Name | (3-methoxyphenyl)methyl-methyl-[(1R)-2-(4-methylanilino)-2-oxo-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 2553869 |
| Molecular Formula | C24H27N2O2+ |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | (3-methoxyphenyl)methyl-methyl-[(1R)-2-(4-methylanilino)-2-oxo-1-phenylethyl]azanium |
| SMILES | COc1cccc(C[NH+](C)[C@@H](C(=O)Nc2ccc(C)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H26N2O2/c1-18-12-14-21(15-13-18)25-24(27)23(20-9-5-4-6-10-20)26(2)17-19-8-7-11-22(16-19)28-3/h4-16,23H,17H2,1-3H3,(H,25,27)/p+1/t23-/m1/s1 |
| InChIKey | QWHLMLFFCMTLRN-HSZRJFAPSA-O |
| XLogP | 3.40 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |