About 1-(1,3-benzodioxol-5-yl)-3-(2,4-difluorophenyl)urea
1-(1,3-benzodioxol-5-yl)-3-(2,4-difluorophenyl)urea (PubChem CID 2554270) has the molecular formula C14H10F2N2O3
and a molecular weight of 292.24 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(2,4-difluorophenyl)urea.
Molecular Properties
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(2,4-difluorophenyl)urea |
| PubChem CID | 2554270 |
| Molecular Formula | C14H10F2N2O3 |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(2,4-difluorophenyl)urea |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C14H10F2N2O3/c15-8-1-3-11(10(16)5-8)18-14(19)17-9-2-4-12-13(6-9)21-7-20-12/h1-6H,7H2,(H2,17,18,19) |
| InChIKey | FESPQLXNCOMFDT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1,3-benzodioxol-5-yl)-3-(2,4-difluorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-benzodioxol-5-yl)-3-(2,4-difluorophenyl)urea?
The IUPAC name of 1-(1,3-benzodioxol-5-yl)-3-(2,4-difluorophenyl)urea (CID 2554270) is 1-(1,3-benzodioxol-5-yl)-3-(2,4-difluorophenyl)urea.
What is the SMILES notation for 1-(1,3-benzodioxol-5-yl)-3-(2,4-difluorophenyl)urea?
The canonical SMILES for 1-(1,3-benzodioxol-5-yl)-3-(2,4-difluorophenyl)urea is O=C(Nc1ccc2c(c1)OCO2)Nc1ccc(F)cc1F.
What is the InChIKey of 1-(1,3-benzodioxol-5-yl)-3-(2,4-difluorophenyl)urea?
The InChIKey is FESPQLXNCOMFDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F2N2O3/c15-8-1-3-11(10(16)5-8)18-14(19)17-9-2-4-12-13(6-9)21-7-20-12/h1-6H,7H2,(H2,17,18,19).
What are the key properties of 1-(1,3-benzodioxol-5-yl)-3-(2,4-difluorophenyl)urea?
1-(1,3-benzodioxol-5-yl)-3-(2,4-difluorophenyl)urea has a molecular weight of 292.24 g/mol, XLogP of 3.34, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzodioxol-5-yl)-3-(2,4-difluorophenyl)urea is sourced from PubChem (CID 2554270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).