C10H6N4O2 — CID 2554659
3,6-bis(furan-2-yl)-1,2,4,5-tetrazine (PubChem CID 2554659) has the molecular formula C10H6N4O2 and a molecular weight of 214.18 g/mol. Its IUPAC name is 3,6-bis(furan-2-yl)-1,2,4,5-tetrazine.
| Compound Name | 3,6-bis(furan-2-yl)-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 2554659 |
| Molecular Formula | C10H6N4O2 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 3,6-bis(furan-2-yl)-1,2,4,5-tetrazine |
| SMILES | c1coc(-c2nnc(-c3ccco3)nn2)c1 |
| InChI | InChI=1S/C10H6N4O2/c1-3-7(15-5-1)9-11-13-10(14-12-9)8-4-2-6-16-8/h1-6H |
| InChIKey | WBVSZPHBBYURDY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |