About [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2,4-difluorobenzoate
[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2,4-difluorobenzoate (PubChem CID 2554766) has the molecular formula C17H19F2NO3
and a molecular weight of 323.34 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2,4-difluorobenzoate.
Molecular Properties
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2,4-difluorobenzoate |
| PubChem CID | 2554766 |
| Molecular Formula | C17H19F2NO3 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2,4-difluorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)cc1F)NCCC1=CCCCC1 |
| InChI | InChI=1S/C17H19F2NO3/c18-13-6-7-14(15(19)10-13)17(22)23-11-16(21)20-9-8-12-4-2-1-3-5-12/h4,6-7,10H,1-3,5,8-9,11H2,(H,20,21) |
| InChIKey | BHUUQEFOLNTAAU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2,4-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2,4-difluorobenzoate?
The IUPAC name of [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2,4-difluorobenzoate (CID 2554766) is [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2,4-difluorobenzoate.
What is the SMILES notation for [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2,4-difluorobenzoate?
The canonical SMILES for [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2,4-difluorobenzoate is O=C(COC(=O)c1ccc(F)cc1F)NCCC1=CCCCC1.
What is the InChIKey of [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2,4-difluorobenzoate?
The InChIKey is BHUUQEFOLNTAAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F2NO3/c18-13-6-7-14(15(19)10-13)17(22)23-11-16(21)20-9-8-12-4-2-1-3-5-12/h4,6-7,10H,1-3,5,8-9,11H2,(H,20,21).
What are the key properties of [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2,4-difluorobenzoate?
[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2,4-difluorobenzoate has a molecular weight of 323.34 g/mol, XLogP of 3.13, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2,4-difluorobenzoate is sourced from PubChem (CID 2554766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).