C23H21N5O5 — CID 2554997
2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)acetamide (PubChem CID 2554997) has the molecular formula C23H21N5O5 and a molecular weight of 447.45 g/mol. Its IUPAC name is 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)acetamide.
| Compound Name | 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 2554997 |
| Molecular Formula | C23H21N5O5 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)acetamide |
| SMILES | Cc1c(NC(=O)CN2C(=O)C(=O)N(Cc3ccccc3)C2=O)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C23H21N5O5/c1-15-19(20(30)28(25(15)2)17-11-7-4-8-12-17)24-18(29)14-27-22(32)21(31)26(23(27)33)13-16-9-5-3-6-10-16/h3-12H,13-14H2,1-2H3,(H,24,29) |
| InChIKey | ZYOPDVMHXBLZGX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 113.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|