About [2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2,4-difluorobenzoate
[2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2,4-difluorobenzoate (PubChem CID 2555172) has the molecular formula C18H17F2NO3
and a molecular weight of 333.33 g/mol. Its IUPAC name is [2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2,4-difluorobenzoate.
Molecular Properties
| Compound Name | [2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2,4-difluorobenzoate |
| PubChem CID | 2555172 |
| Molecular Formula | C18H17F2NO3 |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | [2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2,4-difluorobenzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccc(F)cc2F)c(C)n1C1CC1 |
| InChI | InChI=1S/C18H17F2NO3/c1-10-7-15(11(2)21(10)13-4-5-13)17(22)9-24-18(23)14-6-3-12(19)8-16(14)20/h3,6-8,13H,4-5,9H2,1-2H3 |
| InChIKey | ZZTATQCXECKPDB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2,4-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2,4-difluorobenzoate?
The IUPAC name of [2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2,4-difluorobenzoate (CID 2555172) is [2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2,4-difluorobenzoate.
What is the SMILES notation for [2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2,4-difluorobenzoate?
The canonical SMILES for [2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2,4-difluorobenzoate is Cc1cc(C(=O)COC(=O)c2ccc(F)cc2F)c(C)n1C1CC1.
What is the InChIKey of [2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2,4-difluorobenzoate?
The InChIKey is ZZTATQCXECKPDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F2NO3/c1-10-7-15(11(2)21(10)13-4-5-13)17(22)9-24-18(23)14-6-3-12(19)8-16(14)20/h3,6-8,13H,4-5,9H2,1-2H3.
What are the key properties of [2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2,4-difluorobenzoate?
[2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2,4-difluorobenzoate has a molecular weight of 333.33 g/mol, XLogP of 3.76, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2,4-difluorobenzoate is sourced from PubChem (CID 2555172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).