C21H21FN2O4 — CID 2555715
(E)-N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-N-ethyl-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 2555715) has the molecular formula C21H21FN2O4 and a molecular weight of 384.41 g/mol. Its IUPAC name is (E)-N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-N-ethyl-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-N-ethyl-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2555715 |
| Molecular Formula | C21H21FN2O4 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | (E)-N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-N-ethyl-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | CCN(CC(=O)Nc1ccc2c(c1)OCCO2)C(=O)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C21H21FN2O4/c1-2-24(21(26)10-5-15-3-6-16(22)7-4-15)14-20(25)23-17-8-9-18-19(13-17)28-12-11-27-18/h3-10,13H,2,11-12,14H2,1H3,(H,23,25)/b10-5+ |
| InChIKey | BMRGDANKOOKEDP-BJMVGYQFSA-N |
| XLogP | 3.10 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|