About 2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)-propan-2-ylamino]acetamide
2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)-propan-2-ylamino]acetamide (PubChem CID 2556904) has the molecular formula C17H18N4OS
and a molecular weight of 326.43 g/mol. Its IUPAC name is 2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)-propan-2-ylamino]acetamide.
Molecular Properties
| Compound Name | 2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)-propan-2-ylamino]acetamide |
| PubChem CID | 2556904 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)-propan-2-ylamino]acetamide |
| SMILES | CC(C)N(CC(N)=O)c1ncnc2sc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C17H18N4OS/c1-11(2)21(9-15(18)22)16-13-8-14(12-6-4-3-5-7-12)23-17(13)20-10-19-16/h3-8,10-11H,9H2,1-2H3,(H2,18,22) |
| InChIKey | PXMMRSQLVRINIS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)-propan-2-ylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)-propan-2-ylamino]acetamide?
The IUPAC name of 2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)-propan-2-ylamino]acetamide (CID 2556904) is 2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)-propan-2-ylamino]acetamide.
What is the SMILES notation for 2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)-propan-2-ylamino]acetamide?
The canonical SMILES for 2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)-propan-2-ylamino]acetamide is CC(C)N(CC(N)=O)c1ncnc2sc(-c3ccccc3)cc12.
What is the InChIKey of 2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)-propan-2-ylamino]acetamide?
The InChIKey is PXMMRSQLVRINIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4OS/c1-11(2)21(9-15(18)22)16-13-8-14(12-6-4-3-5-7-12)23-17(13)20-10-19-16/h3-8,10-11H,9H2,1-2H3,(H2,18,22).
What are the key properties of 2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)-propan-2-ylamino]acetamide?
2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)-propan-2-ylamino]acetamide has a molecular weight of 326.43 g/mol, XLogP of 3.06, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)-propan-2-ylamino]acetamide is sourced from PubChem (CID 2556904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).