C20H25NO5S — CID 2557330
2-(3-methylphenoxy)ethyl 4-(diethylsulfamoyl)benzoate (PubChem CID 2557330) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is 2-(3-methylphenoxy)ethyl 4-(diethylsulfamoyl)benzoate.
| Compound Name | 2-(3-methylphenoxy)ethyl 4-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2557330 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 2-(3-methylphenoxy)ethyl 4-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)OCCOc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C20H25NO5S/c1-4-21(5-2)27(23,24)19-11-9-17(10-12-19)20(22)26-14-13-25-18-8-6-7-16(3)15-18/h6-12,15H,4-5,13-14H2,1-3H3 |
| InChIKey | IFFVHLRJNQPRHN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|