C17H17N3O5S2 — CID 2558097
(E)-3-(4-nitrophenyl)-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 2558097) has the molecular formula C17H17N3O5S2 and a molecular weight of 407.47 g/mol. Its IUPAC name is (E)-3-(4-nitrophenyl)-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-nitrophenyl)-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 2558097 |
| Molecular Formula | C17H17N3O5S2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | (E)-3-(4-nitrophenyl)-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)N1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C17H17N3O5S2/c21-16(8-5-14-3-6-15(7-4-14)20(22)23)18-9-11-19(12-10-18)27(24,25)17-2-1-13-26-17/h1-8,13H,9-12H2/b8-5+ |
| InChIKey | DGGNIFYVVUPFIZ-VMPITWQZSA-N |
| XLogP | 2.20 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|