C22H17ClN2O6 — CID 2558490
2-(4-chloro-3-nitrobenzoyl)-N-(2,4-dimethoxyphenyl)benzamide (PubChem CID 2558490) has the molecular formula C22H17ClN2O6 and a molecular weight of 440.84 g/mol. Its IUPAC name is 2-(4-chloro-3-nitrobenzoyl)-N-(2,4-dimethoxyphenyl)benzamide.
| Compound Name | 2-(4-chloro-3-nitrobenzoyl)-N-(2,4-dimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 2558490 |
| Molecular Formula | C22H17ClN2O6 |
| Molecular Weight | 440.84 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 2-(4-chloro-3-nitrobenzoyl)-N-(2,4-dimethoxyphenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccccc2C(=O)c2ccc(Cl)c([N+](=O)[O-])c2)c(OC)c1 |
| InChI | InChI=1S/C22H17ClN2O6/c1-30-14-8-10-18(20(12-14)31-2)24-22(27)16-6-4-3-5-15(16)21(26)13-7-9-17(23)19(11-13)25(28)29/h3-12H,1-2H3,(H,24,27) |
| InChIKey | NAFSJHOGZMEYCA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.84 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|