About 4-(3,5-dimethylpyrazol-1-yl)-N-(4-morpholin-4-ylphenyl)benzamide
4-(3,5-dimethylpyrazol-1-yl)-N-(4-morpholin-4-ylphenyl)benzamide (PubChem CID 2558643) has the molecular formula C22H24N4O2
and a molecular weight of 376.46 g/mol. Its IUPAC name is 4-(3,5-dimethylpyrazol-1-yl)-N-(4-morpholin-4-ylphenyl)benzamide.
Molecular Properties
| Compound Name | 4-(3,5-dimethylpyrazol-1-yl)-N-(4-morpholin-4-ylphenyl)benzamide |
| PubChem CID | 2558643 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 4-(3,5-dimethylpyrazol-1-yl)-N-(4-morpholin-4-ylphenyl)benzamide |
| SMILES | Cc1cc(C)n(-c2ccc(C(=O)Nc3ccc(N4CCOCC4)cc3)cc2)n1 |
| InChI | InChI=1S/C22H24N4O2/c1-16-15-17(2)26(24-16)21-7-3-18(4-8-21)22(27)23-19-5-9-20(10-6-19)25-11-13-28-14-12-25/h3-10,15H,11-14H2,1-2H3,(H,23,27) |
| InChIKey | PDRFEDGWJPGLMR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,5-dimethylpyrazol-1-yl)-N-(4-morpholin-4-ylphenyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethylpyrazol-1-yl)-N-(4-morpholin-4-ylphenyl)benzamide?
The IUPAC name of 4-(3,5-dimethylpyrazol-1-yl)-N-(4-morpholin-4-ylphenyl)benzamide (CID 2558643) is 4-(3,5-dimethylpyrazol-1-yl)-N-(4-morpholin-4-ylphenyl)benzamide.
What is the SMILES notation for 4-(3,5-dimethylpyrazol-1-yl)-N-(4-morpholin-4-ylphenyl)benzamide?
The canonical SMILES for 4-(3,5-dimethylpyrazol-1-yl)-N-(4-morpholin-4-ylphenyl)benzamide is Cc1cc(C)n(-c2ccc(C(=O)Nc3ccc(N4CCOCC4)cc3)cc2)n1.
What is the InChIKey of 4-(3,5-dimethylpyrazol-1-yl)-N-(4-morpholin-4-ylphenyl)benzamide?
The InChIKey is PDRFEDGWJPGLMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N4O2/c1-16-15-17(2)26(24-16)21-7-3-18(4-8-21)22(27)23-19-5-9-20(10-6-19)25-11-13-28-14-12-25/h3-10,15H,11-14H2,1-2H3,(H,23,27).
What are the key properties of 4-(3,5-dimethylpyrazol-1-yl)-N-(4-morpholin-4-ylphenyl)benzamide?
4-(3,5-dimethylpyrazol-1-yl)-N-(4-morpholin-4-ylphenyl)benzamide has a molecular weight of 376.46 g/mol, XLogP of 3.58, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethylpyrazol-1-yl)-N-(4-morpholin-4-ylphenyl)benzamide is sourced from PubChem (CID 2558643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).