acetic acid;4-(aminomethyl)benzenesulfonamide

C9H14N2O4S — CID 25590

IUPACacetic acid;4-(aminomethyl)benzenesulfonamide
SMILESCC(=O)O.NCc1ccc(S(N)(=O)=O)cc1
InChIInChI=1S/C7H10N2O2S.C2H4O2/c8-5-6-1-3-7(4-2-6)12(9,10)11;1-2(3)4/h1-4H,5,8H2,(H2,9,10,11);1H3,(H,3,4)
InChIKeyUILOTUUZKGTYFQ-UHFFFAOYSA-N
MW246.29 g/mol
LogP-0.12
Rot. Bonds2

About acetic acid;4-(aminomethyl)benzenesulfonamide

acetic acid;4-(aminomethyl)benzenesulfonamide (PubChem CID 25590) has the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. Its IUPAC name is acetic acid;4-(aminomethyl)benzenesulfonamide.

Molecular Properties

Compound Nameacetic acid;4-(aminomethyl)benzenesulfonamide
PubChem CID25590
Molecular FormulaC9H14N2O4S
Molecular Weight246.29 g/mol
Exact Mass246.07
IUPAC Nameacetic acid;4-(aminomethyl)benzenesulfonamide
SMILESCC(=O)O.NCc1ccc(S(N)(=O)=O)cc1
InChIInChI=1S/C7H10N2O2S.C2H4O2/c8-5-6-1-3-7(4-2-6)12(9,10)11;1-2(3)4/h1-4H,5,8H2,(H2,9,10,11);1H3,(H,3,4)
InChIKeyUILOTUUZKGTYFQ-UHFFFAOYSA-N
XLogP-0.12
TPSA123.48 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.29
LogP ≤ 5-0.12
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze acetic acid;4-(aminomethyl)benzenesulfonamide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;4-(aminomethyl)benzenesulfonamide?
The IUPAC name of acetic acid;4-(aminomethyl)benzenesulfonamide (CID 25590) is acetic acid;4-(aminomethyl)benzenesulfonamide.
What is the SMILES notation for acetic acid;4-(aminomethyl)benzenesulfonamide?
The canonical SMILES for acetic acid;4-(aminomethyl)benzenesulfonamide is CC(=O)O.NCc1ccc(S(N)(=O)=O)cc1.
What is the InChIKey of acetic acid;4-(aminomethyl)benzenesulfonamide?
The InChIKey is UILOTUUZKGTYFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S.C2H4O2/c8-5-6-1-3-7(4-2-6)12(9,10)11;1-2(3)4/h1-4H,5,8H2,(H2,9,10,11);1H3,(H,3,4).
What are the key properties of acetic acid;4-(aminomethyl)benzenesulfonamide?
acetic acid;4-(aminomethyl)benzenesulfonamide has a molecular weight of 246.29 g/mol, XLogP of -0.12, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;4-(aminomethyl)benzenesulfonamide is sourced from PubChem (CID 25590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).