C21H26N2O3S — CID 2559384
1-(2,5-dimethylthiophen-3-yl)-4-[4-(4-methoxyphenyl)piperazin-1-yl]butane-1,4-dione (PubChem CID 2559384) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is 1-(2,5-dimethylthiophen-3-yl)-4-[4-(4-methoxyphenyl)piperazin-1-yl]butane-1,4-dione.
| Compound Name | 1-(2,5-dimethylthiophen-3-yl)-4-[4-(4-methoxyphenyl)piperazin-1-yl]butane-1,4-dione |
|---|---|
| PubChem CID | 2559384 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-(2,5-dimethylthiophen-3-yl)-4-[4-(4-methoxyphenyl)piperazin-1-yl]butane-1,4-dione |
| SMILES | COc1ccc(N2CCN(C(=O)CCC(=O)c3cc(C)sc3C)CC2)cc1 |
| InChI | InChI=1S/C21H26N2O3S/c1-15-14-19(16(2)27-15)20(24)8-9-21(25)23-12-10-22(11-13-23)17-4-6-18(26-3)7-5-17/h4-7,14H,8-13H2,1-3H3 |
| InChIKey | DFWIXYXJHAAACV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|