About N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-N-methylmethanesulfonamide
N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-N-methylmethanesulfonamide (PubChem CID 2560328) has the molecular formula C11H13N3O2S2
and a molecular weight of 283.38 g/mol. Its IUPAC name is N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-N-methylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-N-methylmethanesulfonamide |
| PubChem CID | 2560328 |
| Molecular Formula | C11H13N3O2S2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-N-methylmethanesulfonamide |
| SMILES | CN(c1ccc(-c2csc(N)n2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C11H13N3O2S2/c1-14(18(2,15)16)9-5-3-8(4-6-9)10-7-17-11(12)13-10/h3-7H,1-2H3,(H2,12,13) |
| InChIKey | YIXKIEAVBDBFMZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-N-methylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-N-methylmethanesulfonamide?
The IUPAC name of N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-N-methylmethanesulfonamide (CID 2560328) is N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-N-methylmethanesulfonamide.
What is the SMILES notation for N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-N-methylmethanesulfonamide?
The canonical SMILES for N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-N-methylmethanesulfonamide is CN(c1ccc(-c2csc(N)n2)cc1)S(C)(=O)=O.
What is the InChIKey of N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-N-methylmethanesulfonamide?
The InChIKey is YIXKIEAVBDBFMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2S2/c1-14(18(2,15)16)9-5-3-8(4-6-9)10-7-17-11(12)13-10/h3-7H,1-2H3,(H2,12,13).
What are the key properties of N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-N-methylmethanesulfonamide?
N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-N-methylmethanesulfonamide has a molecular weight of 283.38 g/mol, XLogP of 1.79, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-N-methylmethanesulfonamide is sourced from PubChem (CID 2560328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).